Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | OSS-128167, also known as SIRT6-IN-1, is a potent and selective SIRT 6 inhibitor with IC50 value of 89 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17048 |
|---|---|
| Formula | C19H14N2O6 |
| Molecular Weight | 366.33 |
| CAS Number | 887686-02-4 |
| SMILES | C1=CC(NC(=O)C2=CC=CO2)=CC(C(=O)NC2=CC=C(O)C(C(O)=O)=C2)=C1 |
| Synonyms | OSS128167, OSS 128167, SIRT6-IN-1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 68 mg/mL (185.62 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 11 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.3 mL | 136.49 mL | 272.98 mL |
| 0.5 mM | 5.46 mL | 27.3 mL | 54.6 mL |
| 1 mM | 2.73 mL | 13.65 mL | 27.3 mL |
| 5 mM | 0.55 mL | 2.73 mL | 5.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
