Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Avibactam sodium (NXL-104) is a covalent and reversible non-β-lactam β-lactamase inhibitor which inhibits β-lactamase TEM-1 and CTX-M-15 with IC50s of 8 nM and 5 nM, respectively. |
|---|
| Catalog Num | A17306 |
|---|---|
| Formula | C7H10N3NaO6S |
| Molecular Weight | 287.23 |
| CAS Number | 1192491-61-4 |
| SMILES | O=S(ON1[C@]2([H])CC[C@@H](C(N)=O)[N@@](C2)C1=O)([O-])=O.[Na+] |
| Synonyms | NXL-104 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (170.59 mM) | |
| Water | 49 mg/mL (170.59 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.82 mL | 174.08 mL | 348.15 mL |
| 0.5 mM | 6.96 mL | 34.82 mL | 69.63 mL |
| 1 mM | 3.48 mL | 17.41 mL | 34.82 mL |
| 5 mM | 0.7 mL | 3.48 mL | 6.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
