Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | AZD0364 is a pre-clinical ERK1/2 inhibitor with an IC50 of 0.6 nM for ERK2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16839 |
|---|---|
| Formula | C24H24F2N8O2 |
| Molecular Weight | 494.5 |
| CAS Number | 2097416-76-5 |
| SMILES | O=C1C2=NC(C3=NC(NC4=CC=NN4C)=NC=C3C)=CN2C[C@H](COC)N1CC5=CC=C(F)C(F)=C5 |
| Synonyms | AZD 0364, AZD-0364 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (188.07 mM) | |
| Water | Insoluble | ||
| Ethanol | 93 mg/mL (188.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.22 mL | 101.11 mL | 202.22 mL |
| 0.5 mM | 4.04 mL | 20.22 mL | 40.44 mL |
| 1 mM | 2.02 mL | 10.11 mL | 20.22 mL |
| 5 mM | 0.4 mL | 2.02 mL | 4.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
