Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BCI-121 is an SMYD3 inhibitor. It acts by impairing cancer cell growth. |
|---|
| Catalog Num | A17065 |
|---|---|
| Formula | C14H18BrN3O2 |
| Molecular Weight | 339.05 |
| CAS Number | 432529-82-3 |
| SMILES | O=C(NC1=CC=C(Br)C=C1)CN2CCC(C(N)=O)CC2 |
| Synonyms | BCI121, BCI 121 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (176.36 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 60 mg/mL (176.36 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.49 mL | 147.47 mL | 294.94 mL |
| 0.5 mM | 5.9 mL | 29.49 mL | 58.99 mL |
| 1 mM | 2.95 mL | 14.75 mL | 29.49 mL |
| 5 mM | 0.59 mL | 2.95 mL | 5.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
