Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bedaquiline fumarate, a diarylquinoline antibiotic that targets ATP synthase, is effective for the treatment of Mycobacterium tuberculosis infections. |
|---|
| Catalog Num | A17444 |
|---|---|
| Formula | C36H35BrN2O6 |
| Molecular Weight | 671.58 |
| CAS Number | 845533-86-0 |
| SMILES | OC(/C=C/C(O)=O)=O.BrC1=CC=C(N=C(OC)C([C@H]([C@@](C2=CC=CC3=C2C=CC=C3)(O)CCN(C)C)C4=CC=CC=C4)=C5)C5=C1 |
| Synonyms | R403323, R 403323, R-403323; TMC207 fumarate, TMC 207, TMC-207; R207910 fumarate, R 207910, R-207910 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (138.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (5.95 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.89 mL | 74.45 mL | 148.9 mL |
| 0.5 mM | 2.98 mL | 14.89 mL | 29.78 mL |
| 1 mM | 1.49 mL | 7.45 mL | 14.89 mL |
| 5 mM | 0.3 mL | 1.49 mL | 2.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
