Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Bifendate is an anti-HBV agent, attenuating hepatic steatosis in cholesterol/bile salt- and high-fat diet-induced hypercholesterolemia in mice. |
|---|
| Catalog Num | A17466 |
|---|---|
| Formula | C20H18O10 |
| Molecular Weight | 418.35 |
| CAS Number | 73536-69-3 |
| SMILES | O=C(C1=CC(OC)=C(OCO2)C2=C1C3=C4OCOC4=C(OC)C=C3C(OC)=O)OC |
| Synonyms | Bifendate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 80 mg/mL (191.22 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.9 mL | 119.52 mL | 239.03 mL |
| 0.5 mM | 4.78 mL | 23.9 mL | 47.81 mL |
| 1 mM | 2.39 mL | 11.95 mL | 23.9 mL |
| 5 mM | 0.48 mL | 2.39 mL | 4.78 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
