Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BS-181 hydrochloride is a highly selective CDK7 inhibitor with IC50 of 21 nM, and > 40-fold selective for CDK7 than CDK1, 2, 4, 5, 6, or 9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21988 |
|---|---|
| Formula | C22H33ClN6 |
| Molecular Weight | 416.99 |
| CAS Number | 1397219-81-6 |
| SMILES | CC(C1=C(N=C(C=C2NCC3=CC=CC=C3)NCCCCCCN)N2N=C1)C.[H]Cl |
| Synonyms | BS181, BS 181 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 81 mg/mL (194.24 mM) | |
| Water | 3 mg/mL (7.19 mM) | ||
| Ethanol | Warmed: 22 mg/mL (52.75 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.98 mL | 119.91 mL | 239.81 mL |
| 0.5 mM | 4.8 mL | 23.98 mL | 47.96 mL |
| 1 mM | 2.4 mL | 11.99 mL | 23.98 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
