Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Carbazochrome, also known as Adona and AC-17, is a hemostatic which increases capillary resistance and activates platelet factors. |
|---|
| Catalog Num | A17519 |
|---|---|
| Formula | C10H12N4O3 |
| Molecular Weight | 236.23 |
| CAS Number | 69-81-8 |
| SMILES | O=C1/C(C=C2C(O)CN(C)C2=C1)=N\NC(N)=O |
| Synonyms | Carbazochrome; AC-17; AC 17; AC17; Adona |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 30 mg/mL (126.99 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.33 mL | 211.66 mL | 423.32 mL |
| 0.5 mM | 8.47 mL | 42.33 mL | 84.66 mL |
| 1 mM | 4.23 mL | 21.17 mL | 42.33 mL |
| 5 mM | 0.85 mL | 4.23 mL | 8.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
