Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefoxitin Sodium is a semisynthetic cephamycin antibiotic resistant to beta-lactamase. It is derived from Cephamycin C and is highly resistance to β-lactamase inactivation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17431 |
|---|---|
| Formula | C16H16N3NaO7S2 |
| Molecular Weight | 449.43 |
| CAS Number | 33564-30-6 |
| SMILES | CO[C@@]1([C@@H]2N(C1=O)C(=C(CS2)COC(=O)N)C(=O)[O-])NC(=O)CC3=CC=CS3.[Na+] |
| Synonyms | Cefoxitin Sodium; Cefoxitin sodium salt; Cenomycin; Betacef; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (169.1 mM) | |
| Water | 76 mg/mL (169.1 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.25 mL | 111.25 mL | 222.5 mL |
| 0.5 mM | 4.45 mL | 22.25 mL | 44.5 mL |
| 1 mM | 2.23 mL | 11.13 mL | 22.25 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
