Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefazedone is a semisynthetic first-generation cephalosporin with antibacterial activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17455 |
|---|---|
| Formula | C18H15Cl2N5O5S3 |
| Molecular Weight | 548.42 |
| CAS Number | 56187-47-4 |
| SMILES | O=C(C(N12)=C(CSC3=NN=C(C)S3)CS[C@]2([H])[C@H](NC(CN(C=C4Cl)C=C(Cl)C4=O)=O)C1=O)O |
| Synonyms | Cefazedone; Refosporen, Cefazedonum |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (173.21 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.23 mL | 91.17 mL | 182.34 mL |
| 0.5 mM | 3.65 mL | 18.23 mL | 36.47 mL |
| 1 mM | 1.82 mL | 9.12 mL | 18.23 mL |
| 5 mM | 0.36 mL | 1.82 mL | 3.65 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
