Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CFTR corrector 2 is a cystic fibrosis transmembrane conductance corrector (CFTR), extracted from patent US20140274933. |
|---|
| Catalog Num | A18528 |
|---|---|
| Formula | C27H23FN4O4 |
| Molecular Weight | 486.49 |
| CAS Number | 1628416-28-3 |
| SMILES | O=C(N(C)C1=CC=C2N=C(C)OC2=C1)CN(N=C(C3=CC=CC(F)=C3)C4=C5C=C(OCC)C=C4)C5=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 32 mg/mL (65.77 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (16.44 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.56 mL | 102.78 mL | 205.55 mL |
| 0.5 mM | 4.11 mL | 20.56 mL | 41.11 mL |
| 1 mM | 2.06 mL | 10.28 mL | 20.56 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
