Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ciclesonide is a glucocorticoid used to treat obstructive airway diseases. |
|---|
| Catalog Num | A16145 |
|---|---|
| Formula | C32H44O7 |
| Molecular Weight | 540.69 |
| CAS Number | 126544-47-6 |
| SMILES | CC(C)C(=O)OCC(=O)C12C(CC3C1(CC(C4C3CCC5=CC(=O)C=CC45C)O)C)OC(O2)C6CCCCC6 |
| Synonyms | Alvesco, Omnaris, RPR251526 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (183.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 99 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.49 mL | 92.47 mL | 184.95 mL |
| 0.5 mM | 3.7 mL | 18.49 mL | 36.99 mL |
| 1 mM | 1.85 mL | 9.25 mL | 18.49 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
