Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CID16020046 is a selective GPR55 antagonist, inhibiting GPR55 constitutive activity with IC50 of 0.15 μM in yeast. It demonstrates weak activity against a broad spectrum of other GPCRs, ion channels, kinases, and nuclear receptor. |
|---|
| Catalog Num | A16818 |
|---|---|
| Formula | C25H19N3O4 |
| Molecular Weight | 425.44 |
| CAS Number | 834903-43-4 |
| SMILES | O=C(O)C1=CC=C(N(C2=O)C(C3=CC=CC(O)=C3)C4=C2NN=C4C5=CC=C(C)C=C5)C=C1 |
| Synonyms | C390-0219, CID 16020046, CID-16020046 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (180.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.51 mL | 117.53 mL | 235.05 mL |
| 0.5 mM | 4.7 mL | 23.51 mL | 47.01 mL |
| 1 mM | 2.35 mL | 11.75 mL | 23.51 mL |
| 5 mM | 0.47 mL | 2.35 mL | 4.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
