Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Clobetasol propionate is a anti-inflammatory corticosteroid used to treat various skin disorders. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11835 |
|---|---|
| Formula | C25H32ClFO5 |
| Molecular Weight | 466.97 |
| CAS Number | 25122-46-7 |
| SMILES | C[C@@]12[C@](C(CCl)=O)(OC(CC)=O)[C@@H](C)C[C@@]1([H])[C@]3([H])CCC4=CC(C=C[C@]4(C)[C@@]3(F)[C@@H](O)C2)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (169.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 17 mg/mL (36.4 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.41 mL | 107.07 mL | 214.15 mL |
| 0.5 mM | 4.28 mL | 21.41 mL | 42.83 mL |
| 1 mM | 2.14 mL | 10.71 mL | 21.41 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
