Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dooku1, an analog of Yoda1, is a selective antagonist of the endogenous Piezo1 channel. |
|---|
| Catalog Num | A18409 |
|---|---|
| Formula | C13H9Cl2N3OS |
| Molecular Weight | 326.2 |
| CAS Number | 2253744-54-4 |
| SMILES | ClC1=C(C(Cl)=CC=C1)CSC2=NN=C(C3=CC=CN3)O2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 60 mg/mL (183.93 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (15.32 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.66 mL | 153.28 mL | 306.56 mL |
| 0.5 mM | 6.13 mL | 30.66 mL | 61.31 mL |
| 1 mM | 3.07 mL | 15.33 mL | 30.66 mL |
| 5 mM | 0.61 mL | 3.07 mL | 6.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
