Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Afobazole is a selective anxiolytic. It produces anxiolytic and neuroprotective effects without any sedative or muscle relaxant actions. |
|---|
| Catalog Num | A18046 |
|---|---|
| Formula | C15H22ClN3O2S |
| Molecular Weight | 343.9 |
| CAS Number | 173352-39-1 |
| SMILES | CCOC1=CC2=C(C=C1)N=C(N2)SCCN3CCOCC3.Cl |
| Synonyms | Afobazole |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (183.2 mM) | |
| Water | 63 mg/mL (183.2 mM) | ||
| Ethanol | 63 mg/mL (183.2 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.08 mL | 145.39 mL | 290.78 mL |
| 0.5 mM | 5.82 mL | 29.08 mL | 58.16 mL |
| 1 mM | 2.91 mL | 14.54 mL | 29.08 mL |
| 5 mM | 0.58 mL | 2.91 mL | 5.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
