Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IBMX is a broad-spectrum phosphodiesterase (PDE) inhibitor, with IC50s of 6.5, 26.3 and 31.7 μM for PDE3, PDE4 and PDE5, respectively. |
|---|
| Catalog Num | A21847 |
|---|---|
| Formula | C10H14N4O2 |
| Molecular Weight | 222.24 |
| CAS Number | 28822-58-4 |
| SMILES | O=C(N1C)N(CC(C)C)C2=C(N=CN2)C1=O |
| Synonyms | 3-Isobutyl-1-methylxanthine; Isobutylmethylxanthine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (193.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45 mL | 224.98 mL | 449.96 mL |
| 0.5 mM | 9 mL | 45 mL | 89.99 mL |
| 1 mM | 4.5 mL | 22.5 mL | 45 mL |
| 5 mM | 0.9 mL | 4.5 mL | 9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
