Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | L-Glutamic acid monosodium salt acts as an excitatory transmitter and an agonist at all subtypes of glutamate receptors (metabotropic, kainate, NMDA, and AMPA). (S)-Glutamic acid shows a direct activating effect on the release of DA from dopaminergic terminals. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16591 |
|---|---|
| Formula | C5H8NNaO4 |
| Molecular Weight | 169.11 |
| CAS Number | 142-47-2 |
| SMILES | [O-]C(CC[C@H](N)C(O)=O)=O.[Na+] |
| Synonyms | Monosodium glutamate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 31 mg/mL (183.3 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 59.13 mL | 295.67 mL | 591.33 mL |
| 0.5 mM | 11.83 mL | 59.13 mL | 118.27 mL |
| 1 mM | 5.91 mL | 29.57 mL | 59.13 mL |
| 5 mM | 1.18 mL | 5.91 mL | 11.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
