Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | L-lysine hydrochloride is an essential amino acid for humans with various benefits including treating herpes, increasing calcium absorption, reducing diabetes-related illnesses and improving gut health. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17924 |
|---|---|
| Formula | C6H15ClN2O2 |
| Molecular Weight | 182.65 |
| CAS Number | 657-27-2 |
| SMILES | N[C@@H](CCCCN)C(O)=O.[H]Cl |
| Synonyms | Lysine hydrochloride; NSC 9253; NSC-9253; NSC9253 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 86 mg/mL (470.84 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 54.75 mL | 273.75 mL | 547.5 mL |
| 0.5 mM | 10.95 mL | 54.75 mL | 109.5 mL |
| 1 mM | 5.47 mL | 27.37 mL | 54.75 mL |
| 5 mM | 1.09 mL | 5.47 mL | 10.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
