Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY2562175 is a potent and selective FXR agonist in vitro and has robust lipid modulating properties, lowering LDL and triglycerides while raising HDL in preclinical species. |
|---|
| Catalog Num | A17016 |
|---|---|
| Formula | C28H27Cl2N3O4 |
| Molecular Weight | 540.44 |
| CAS Number | 1103500-20-4 |
| SMILES | O=C(C1=CN(C)C2=C1C=CC(N3CCC(OCC4=C(C5CC5)ON=C4C6=C(Cl)C=CC=C6Cl)CC3)=C2)O |
| Synonyms | LY 2562175, LY-2562175 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (168.38 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (1.85 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.5 mL | 92.52 mL | 185.03 mL |
| 0.5 mM | 3.7 mL | 18.5 mL | 37.01 mL |
| 1 mM | 1.85 mL | 9.25 mL | 18.5 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
