Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pantoprazole is a proton pump inhibitor drug that inhibits gastric acid secretion. |
|---|
| Catalog Num | A11696 |
|---|---|
| Formula | C16H15F2N3O4S |
| Molecular Weight | 383.37 |
| CAS Number | 102625-70-7 |
| SMILES | COC1=C(C(=NC=C1)CS(=O)C2=NC3=C(N2)C=C(C=C3)OC(F)F)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (193.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 74 mg/mL (193.02 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.08 mL | 130.42 mL | 260.84 mL |
| 0.5 mM | 5.22 mL | 26.08 mL | 52.17 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.08 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
