Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PRT 4165 is an inhibitor of Bmi1/Ring1A, subunits of the polycomb repressive complex 1 (PRC1). It prevents Bmi1/Ring1A-mediated ubiquitination and drug-induced degradation of topoisomerase 2alpha. |
|---|
| Catalog Num | A15453 |
|---|---|
| Formula | C15H9NO2 |
| Molecular Weight | 235.24 |
| CAS Number | 31083-55-3 |
| SMILES | O=C(C1=CC=CC=C1C/2=O)C2=C\C3=CC=CN=C3 |
| Synonyms | PRT4165, PRT-4165 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (42.51 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (12.75 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.51 mL | 212.55 mL | 425.1 mL |
| 0.5 mM | 8.5 mL | 42.51 mL | 85.02 mL |
| 1 mM | 4.25 mL | 21.25 mL | 42.51 mL |
| 5 mM | 0.85 mL | 4.25 mL | 8.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
