Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (R)-MG-132 ((S,R,S)-(-)-MG-132) is the enantiomer of MG-132. (R)-MG-132 is a proteasome inhibitor with weaker cell cytotoxicity than MG-132. (R)-MG-132 stereoisomer is a more potent proteasome inhibitor than MG-132. |
|---|
| Catalog Num | A21980 |
|---|---|
| Formula | C26H41N3O5 |
| Molecular Weight | 475.62 |
| CAS Number | 1211877-36-9 |
| SMILES | CC(C)C[C@H](C(N)=O)N(C([C@H](CC(C)C)NC(OCC1=CC=CC=C1)=O)=O)[C@H](C=O)CC(C)C |
| Synonyms | (S,R,S)-(-)-MG-132 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 77 mg/mL (161.89 mM) | |
| Water | Insoluble | ||
| Ethanol | 22 mg/mL | ||
| In vivo | 4% DMSO+30% PEG 300+20% propylene glycol+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.03 mL | 105.13 mL | 210.25 mL |
| 0.5 mM | 4.21 mL | 21.03 mL | 42.05 mL |
| 1 mM | 2.1 mL | 10.51 mL | 21.03 mL |
| 5 mM | 0.42 mL | 2.1 mL | 4.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
