Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Raltegravir is a potent integrase (IN) inhibitor, used to treat HIV infection. |
|---|
| Catalog Num | A21403 |
|---|---|
| Formula | C20H21FN6O5 |
| Molecular Weight | 444.42 |
| CAS Number | 871038-72-1 |
| SMILES | O=C(C(O)=C(C(NCC1=CC=C(C=C1)F)=O)N=C2C(C)(C)NC(C3=NN=C(C)O3)=O)N2C |
| Synonyms | MK-0518 potassium, MK0518, MK 0518 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (188.59 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL (20.72 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.5 mL | 112.51 mL | 225.01 mL |
| 0.5 mM | 4.5 mL | 22.5 mL | 45 mL |
| 1 mM | 2.25 mL | 11.25 mL | 22.5 mL |
| 5 mM | 0.45 mL | 2.25 mL | 4.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
