Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | (S)-2-Hydroxy-3-phenylpropanoic acid is a product of phenylalanine catabolism. An elevated level of phenyllactic acid is found in body fluids of patients with or phenylketonuria. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12566 |
|---|---|
| Formula | C9H10O3 |
| Molecular Weight | 166.17 |
| CAS Number | 20312-36-1 |
| SMILES | O=C(O)[C@@H](O)CC1=CC=CC=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 28 mg/mL (168.5 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 60.18 mL | 300.9 mL | 601.79 mL |
| 0.5 mM | 12.04 mL | 60.18 mL | 120.36 mL |
| 1 mM | 6.02 mL | 30.09 mL | 60.18 mL |
| 5 mM | 1.2 mL | 6.02 mL | 12.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
