Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sulfasalazine is a drug for the treatment of rheumatoid arthritis and ulcerative colitis. Sulfasalazine is reported to suppress NF-κB activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10876 |
|---|---|
| Formula | C18H14N4O5S |
| Molecular Weight | 398.39 |
| CAS Number | 599-79-1 |
| SMILES | OC(C1=C(O)C=CC(/N=N/C2=CC=C(S(=O)(NC3=NC=CC=C3)=O)C=C2)=C1)=O |
| Synonyms | NSC 667219, NSC667219, NSC-667219 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (175.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.1 mL | 125.51 mL | 251.01 mL |
| 0.5 mM | 5.02 mL | 25.1 mL | 50.2 mL |
| 1 mM | 2.51 mL | 12.55 mL | 25.1 mL |
| 5 mM | 0.5 mL | 2.51 mL | 5.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
