Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Tamoxifen (ICI 47699) is a selective estrogen receptor modulator (SERM) which blocks estrogen action in breast cells and can activate estrogen activity in other cells, such as bone, liver, and uterine cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16738 |
|---|---|
| Formula | C26H29NO |
| Molecular Weight | 371.51 |
| CAS Number | 10540-29-1 |
| SMILES | CC/C(C1=CC=CC=C1)=C(C2=CC=C(OCCN(C)C)C=C2)\C3=CC=CC=C3 |
| Synonyms | ICI 47699; (Z)-Tamoxifen; trans-Tamoxifen |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 68 mg/mL (183.03 mM) | |
| Water | Insoluble | ||
| Ethanol | 68 mg/mL | ||
| In vivo | 2% DMSO+30% PEG 300+2% Tween 80+ddH2O | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.92 mL | 134.59 mL | 269.17 mL |
| 0.5 mM | 5.38 mL | 26.92 mL | 53.83 mL |
| 1 mM | 2.69 mL | 13.46 mL | 26.92 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
