Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | TP0463518 is a potent hypoxia-inducible factor prolyl hydroxylases (PHDs) inhibitor with a Ki value of 5.3 nM for human PHD2. |
|---|
| Catalog Num | A20183 |
|---|---|
| Formula | C20H18ClN3O6 |
| Molecular Weight | 431.83 |
| CAS Number | 1558021-37-6 |
| SMILES | ClC(C=C1)=CC=C1OC2=NC=C(CN3C(C(C(NCC(O)=O)=O)=C(O)CC3)=O)C=C2 |
| Synonyms | TP 0463518, TP-0463518 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 34 mg/mL (78.73 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.16 mL | 115.79 mL | 231.57 mL |
| 0.5 mM | 4.63 mL | 23.16 mL | 46.31 mL |
| 1 mM | 2.32 mL | 11.58 mL | 23.16 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
