Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ML216 (CID-49852229) is a potent, selective and cell permeable inhibitor of the DNA unwinding activity of BLM helicase with IC50s of 2.98 μM and 0.97 μM for BLMfull-length and BLM636-1298, respectively. |
|---|
| Catalog Num | A21754 |
|---|---|
| Formula | C15H9F4N5OS |
| Molecular Weight | 383.32 |
| CAS Number | 1430213-30-1 |
| SMILES | O=C(NC1=CC=C(F)C(C(F)(F)F)=C1)NC2=NN=C(S2)C3=CC=NC=C3 |
| Synonyms | CID-49852229, CID49852229, CID 49852229; ML-216, ML 216 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 33 mg/mL (86.09 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.09 mL | 130.44 mL | 260.88 mL |
| 0.5 mM | 5.22 mL | 26.09 mL | 52.18 mL |
| 1 mM | 2.61 mL | 13.04 mL | 26.09 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.22 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
