Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Norepinephrine (Levarterenol; L-Noradrenaline) is a β1-selective adrenergic receptor agonist with EC50 of 5.37 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11306 |
|---|---|
| Formula | C8H11NO3 |
| Molecular Weight | 169.18 |
| CAS Number | 51-41-2 |
| SMILES | OC1=CC=C([C@@H](O)CN)C=C1O |
| Synonyms | Levarterenol; L-Noradrenaline |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (59.1 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 59.11 mL | 295.54 mL | 591.09 mL |
| 0.5 mM | 11.82 mL | 59.11 mL | 118.22 mL |
| 1 mM | 5.91 mL | 29.55 mL | 59.11 mL |
| 5 mM | 1.18 mL | 5.91 mL | 11.82 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
