Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Oxyclozanide is a salicylanilide anthelmintic that is a proton ionophore which uncouples oxidative phosphorylation of the target organism. |
|---|
| Catalog Num | A16979 |
|---|---|
| Formula | C13H6Cl5NO3 |
| Molecular Weight | 401.44 |
| CAS Number | 2277-92-1 |
| SMILES | OC1=C(Cl)C=C(Cl)C(Cl)=C1C(NC2=CC(Cl)=CC(Cl)=C2O)=O |
| Synonyms | Diplin, ICI 46683, ICI-46683, ICI46683, Oxiclozanida, Zanilox |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (189.31 mM) | |
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.91 mL | 124.55 mL | 249.1 mL |
| 0.5 mM | 4.98 mL | 24.91 mL | 49.82 mL |
| 1 mM | 2.49 mL | 12.46 mL | 24.91 mL |
| 5 mM | 0.5 mL | 2.49 mL | 4.98 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
