Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Adrafinil, also known as CRL 40028, is a eugeroic that was formerly used in France to promote alertness, attention, wakefulness, mood, and other parameters, particularly in the elderly. |
|---|
| Catalog Num | A17561 |
|---|---|
| Formula | C15H15NO3S |
| Molecular Weight | 289.35 |
| CAS Number | 63547-13-7 |
| SMILES | O=C(NO)CS(C(C1=CC=CC=C1)C2=CC=CC=C2)=O |
| Synonyms | Adrafinil; CRL 40028; CRL-40028; CRL40028; brand name Olmifon. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (193.53 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.56 mL | 172.8 mL | 345.6 mL |
| 0.5 mM | 6.91 mL | 34.56 mL | 69.12 mL |
| 1 mM | 3.46 mL | 17.28 mL | 34.56 mL |
| 5 mM | 0.69 mL | 3.46 mL | 6.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
