Signaling Pathway
VEGFR-2 inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Apatinib (YN968D1) is an orally bioavailable tyrosine kinase inhibitor, which selectively targets VEGFR-2 with an IC50 of 1 nM. |
|---|
| Catalog Num | A17249 |
|---|---|
| Formula | C25H27N5O4S |
| Molecular Weight | 493.58 |
| CAS Number | 1218779-75-9 |
| SMILES | O=C(C1=CC=CN=C1NCC2=CC=NC=C2)NC3=CC=C(C4(C#N)CCCC4)C=C3.CS(=O)(O)=O |
| Synonyms | YN968D1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 20 mg/mL (40.52 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC | 5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.26 mL | 101.3 mL | 202.6 mL |
| 0.5 mM | 4.05 mL | 20.26 mL | 40.52 mL |
| 1 mM | 2.03 mL | 10.13 mL | 20.26 mL |
| 5 mM | 0.41 mL | 2.03 mL | 4.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
