Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Btk inhibitor 2 is a Bruton's tyrosine kinase (BTK) inhibitor. |
|---|
| Catalog Num | A17057 |
|---|---|
| Formula | C24H25N5O3 |
| Molecular Weight | 431.49 |
| CAS Number | 1558036-85-3 |
| SMILES | O=C(C1=C(N)N([C@H]2CN(C(C=C)=O)CCC2)N=C1C3=CC=C(OC4=CC=CC=C4)C=C3)N |
| Synonyms | Btk-inhibitor-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 75 mg/mL (173.81 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (18.53 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.18 mL | 115.88 mL | 231.76 mL |
| 0.5 mM | 4.64 mL | 23.18 mL | 46.35 mL |
| 1 mM | 2.32 mL | 11.59 mL | 23.18 mL |
| 5 mM | 0.46 mL | 2.32 mL | 4.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
