Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BAY 41-2272 is a direct and NO-independent soluble guanylate cyclase (sGC) stimulator. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15891 |
|---|---|
| Formula | C20H17FN6 |
| Molecular Weight | 360.39 |
| CAS Number | 256376-24-6 |
| SMILES | NC1=NC(C2=NN(CC3=CC=CC=C3F)C4=NC=CC=C42)=NC=C1C5CC5 |
| Synonyms | BAY-41-2272, BAY41-2272, BAY412272 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 31 mg/mL (86.01 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 4 mg/mL (11.09 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.75 mL | 138.74 mL | 277.48 mL |
| 0.5 mM | 5.55 mL | 27.75 mL | 55.5 mL |
| 1 mM | 2.77 mL | 13.87 mL | 27.75 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
