Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BRD4 Inhibitor-10 is a potent BRD4-BD1 inhibitor extracted from patent WO2015022332A1, Compound II-25, has an IC50 of 8 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18679 |
|---|---|
| Formula | C25H27N5O2 |
| Molecular Weight | 429.51 |
| CAS Number | 1660117-38-3 |
| SMILES | CN1C(C(C)=CC(C2=NC3=CN=C(C=C3N2[C@H](C4=CC=CC=C4)C)C5CCOCC5)=N1)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 83 mg/mL (193.24 mM) | |
| Water | Insoluble | ||
| Ethanol | 83 mg/mL (193.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.28 mL | 116.41 mL | 232.82 mL |
| 0.5 mM | 4.66 mL | 23.28 mL | 46.56 mL |
| 1 mM | 2.33 mL | 11.64 mL | 23.28 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
