Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CX-4945 sodium salt is a potent and selective ATP-competitive small molecule protein kinase CK2 inhibitor with a Ki and an IC50 of 0.38 and 1 nM for recombinant human CK2α, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16234 |
|---|---|
| Formula | C19H11ClN3NaO2 |
| Molecular Weight | 371.75 |
| CAS Number | 1309357-15-0 |
| SMILES | C1=CC(=CC(=C1)Cl)NC2=NC3=C(C=CC(=C3)C(=O)[O-])C4=C2C=CN=C4.[Na+] |
| Synonyms | Silmitasertib sodium salt |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (174.84 mM) | |
| Water | 65 mg/mL (174.84 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.9 mL | 134.5 mL | 269 mL |
| 0.5 mM | 5.38 mL | 26.9 mL | 53.8 mL |
| 1 mM | 2.69 mL | 13.45 mL | 26.9 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
