Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Canrenone is a metabolite of spironolactone, Na/K ATPase partial agonist and aldosterone and androgen receptor antagonist used as a diuretic. |
|---|
| Catalog Num | A17574 |
|---|---|
| Formula | C22H26O6 |
| Molecular Weight | 386.44 |
| CAS Number | 976-71-6 |
| SMILES | O=C1CC[C@]2(CO3)C4CC[C@]5(C3=O)[C@](O)(CCC(O)=O)CC[C@@]5([H])[C@]4([H])C=CC2=C1 |
| Synonyms | Aldadiene; BRN 0046602; BRN-0046602; BRN0046602; Luvion; NSC 261713; NSC-261713; NSC 261713Phanurane |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (196.78 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.88 mL | 129.39 mL | 258.77 mL |
| 0.5 mM | 5.18 mL | 25.88 mL | 51.75 mL |
| 1 mM | 2.59 mL | 12.94 mL | 25.88 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
