Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cefonicid sodium is a broadspectrum cephalosporin antibiotic which inhibits the formation of the bacterial cell wall. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17282 |
|---|---|
| Formula | C18H16N6Na2O8S3 |
| Molecular Weight | 586.53 |
| CAS Number | 61270-78-8 |
| SMILES | C1C(=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)[C@@H](C3=CC=CC=C3)O)C(=O)[O-])CSC4=NN=NN4CS(=O)(=O)[O-].[Na+].[Na+] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (153.44 mM) | |
| Water | 90 mg/mL (153.44 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.05 mL | 85.25 mL | 170.49 mL |
| 0.5 mM | 3.41 mL | 17.05 mL | 34.1 mL |
| 1 mM | 1.7 mL | 8.52 mL | 17.05 mL |
| 5 mM | 0.34 mL | 1.7 mL | 3.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
