Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dehydrocholic acid is a synthetic bile acid, manufactured by the oxidation of cholic acid. |
|---|
| Catalog Num | A16151 |
|---|---|
| Formula | C24H34O5 |
| Molecular Weight | 402.52 |
| CAS Number | 81-23-2 |
| SMILES | CC(CCC(=O)O)C1CCC2C1(C(=O)CC3C2C(=O)CC4C3(CCC(=O)C4)C)C |
| Synonyms | Decholin, Dehystolin, Felacrinos, Sanocholen |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (173.9 mM) | |
| Water | Insoluble | ||
| Ethanol | 13 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.84 mL | 124.22 mL | 248.43 mL |
| 0.5 mM | 4.97 mL | 24.84 mL | 49.69 mL |
| 1 mM | 2.48 mL | 12.42 mL | 24.84 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.97 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
