Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ifenprodil tartrate is the atypical N-methyl-D-aspartate (NMDA) receptor antagonist, inhibits NMDA-induced currents at NR1A/NR2B receptors with high affinity (IC50 = 0.34 μM). |
|---|
| Catalog Num | A16583 |
|---|---|
| Formula | C21H27NO2 . 1/2C4H6O6 |
| Molecular Weight | 400.49 |
| CAS Number | 23210-58-4 |
| SMILES | OC(C1=CC=C(O)C=C1)C(C)N(CC2)CCC2CC3=CC=CC=C3.O=C(O)[C@H](O)[C@@H](O)C(O)=O.OC(C4=CC=C(O)C=C4)C(C)N(CC5)CCC5CC6=CC=CC=C6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (109.86 mM) | |
| Water | 8 mg/mL (9.98 mM) | ||
| Ethanol | 58 mg/mL (72.41 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.97 mL | 124.85 mL | 249.69 mL |
| 0.5 mM | 4.99 mL | 24.97 mL | 49.94 mL |
| 1 mM | 2.5 mL | 12.48 mL | 24.97 mL |
| 5 mM | 0.5 mL | 2.5 mL | 4.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
