Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Indirubin-3'-monoxime is a powerful inhibitor of GSK-3β with IC50 of 22nM, also inhibits CDK1/5 (IC50 = 180/100 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16280 |
|---|---|
| Formula | C16H11N3O2 |
| Molecular Weight | 277.28 |
| CAS Number | 160807-49-8 |
| SMILES | O=C1N=C2C(C=CC=C2)=C1C(NC3=CC=CC=C43)=C4NO |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (191.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 36.06 mL | 180.32 mL | 360.65 mL |
| 0.5 mM | 7.21 mL | 36.06 mL | 72.13 mL |
| 1 mM | 3.61 mL | 18.03 mL | 36.06 mL |
| 5 mM | 0.72 mL | 3.61 mL | 7.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
