Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JG-98, an allosteric heat shock protein 70 (Hsp70) inhibitor, which binds tightly to a conserved site on Hsp70 and disrupts the Hsp70-Bag3 interaction. JG-98 shows anti-cancer activities affecting both cancer cells and tumor-associated macrophages. |
|---|
| Catalog Num | A18734 |
|---|---|
| Formula | C24H21Cl2N3OS3 |
| Molecular Weight | 534.54 |
| CAS Number | 1456551-16-8 |
| SMILES | CN1/C(SC2=CC(Cl)=CC=C12)=C3S/C(N(CC)C\3=O)=C\C4=[N+](C=CS4)CC5=CC=CC=C5.[Cl-] |
| Synonyms | JG98, JG 98 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 7 mg/mL (13.09 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.71 mL | 93.54 mL | 187.08 mL |
| 0.5 mM | 3.74 mL | 18.71 mL | 37.42 mL |
| 1 mM | 1.87 mL | 9.35 mL | 18.71 mL |
| 5 mM | 0.37 mL | 1.87 mL | 3.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
