Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LDN-57444 is a potent, reversible, competitive and active site-directed inhibitor of UCHL1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12715 |
|---|---|
| Formula | C17H11Cl3N2O3 |
| Molecular Weight | 397.64 |
| CAS Number | 668467-91-2 |
| SMILES | CC(=O)O/N=C/1\C2=C(C=CC(=C2)Cl)N(C1=O)CC3=C(C=CC(=C3)Cl)Cl |
| Synonyms | C30, LDN 57444, LDN57444 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 11 mg/mL (27.66 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.15 mL | 125.74 mL | 251.48 mL |
| 0.5 mM | 5.03 mL | 25.15 mL | 50.3 mL |
| 1 mM | 2.51 mL | 12.57 mL | 25.15 mL |
| 5 mM | 0.5 mL | 2.51 mL | 5.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
