Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Letermovir is a novel inhibitor of CMV, which targets the viral terminase complex and remains active against virus resistant to DNA polymerase inhibitors. |
|---|
| Catalog Num | A21248 |
|---|---|
| Formula | C29H28F4N4O4 |
| Molecular Weight | 572.55 |
| CAS Number | 917389-32-3 |
| SMILES | FC1=C(N=C(N2CCN(C3=CC=CC(OC)=C3)CC2)N(C4=CC(C(F)(F)F)=CC=C4OC)[C@H]5CC(O)=O)C5=CC=C1 |
| Synonyms | AIC246 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (157.19 mM) | |
| Water | Insoluble | ||
| Ethanol | 90 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.47 mL | 87.33 mL | 174.66 mL |
| 0.5 mM | 3.49 mL | 17.47 mL | 34.93 mL |
| 1 mM | 1.75 mL | 8.73 mL | 17.47 mL |
| 5 mM | 0.35 mL | 1.75 mL | 3.49 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
