Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pyrimethamine(RP4753) is a medication used for protozoal infections; interferes with tetrahydrofolic acid synthesis from folic acid by inhibiting the enzyme dihydrofolate reductase (DHFR). |
|---|
| Catalog Num | A10763 |
|---|---|
| Formula | C12H13ClN4 |
| Molecular Weight | 248.71 |
| CAS Number | 58-14-0 |
| SMILES | NC1=NC(N)=C(C2=CC=C(Cl)C=C2)C(CC)=N1 |
| Synonyms | Pirimecidan; Pirimetamin; RP 4753, RP-4753, RP4753 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 10 mg/mL (40.2 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.21 mL | 201.04 mL | 402.07 mL |
| 0.5 mM | 8.04 mL | 40.21 mL | 80.41 mL |
| 1 mM | 4.02 mL | 20.1 mL | 40.21 mL |
| 5 mM | 0.8 mL | 4.02 mL | 8.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
