Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pyrvinium pamoate is an FDA-approved antihelmintic drug that inhibits WNT pathway signaling. |
|---|
| Catalog Num | A17784 |
|---|---|
| Formula | C75H70N6O6 |
| Molecular Weight | 1151.42 |
| CAS Number | 3546-41-6 |
| SMILES | CN(C)C1=CC2=C([N+](C)=C(/C=C/C3=C(C)N(C4=CC=CC=C4)C(C)=C3)C=C2)C=C1.CN(C)C5=CC6=C([N+](C)=C(/C=C/C7=C(C)N(C8=CC=CC=C8)C(C)=C7)C=C6)C=C5.[O-]C(C9=CC%10=C(C=CC=C%10)C(CC%11=C(O)C(C([O-])=O)=CC%12=C%11C=CC=C%12)=C9O)=O |
| Synonyms | VPC-14337; VPC 14337; VPC14337; Pyrvinium pamoate; Pyrvinium embonate; Viprynium embonate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 20 mg/mL (17.36 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.68 mL | 43.42 mL | 86.85 mL |
| 0.5 mM | 1.74 mL | 8.68 mL | 17.37 mL |
| 1 mM | 0.87 mL | 4.34 mL | 8.68 mL |
| 5 mM | 0.17 mL | 0.87 mL | 1.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
