Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pirenzepine dihydrochloride (LS519) is a selective M1 muscarinic receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17916 |
|---|---|
| Formula | C19H23Cl2N5O2 |
| Molecular Weight | 424.32 |
| CAS Number | 29868-97-1 |
| SMILES | O=C1NC2=CC=CN=C2N(C(CN3CCN(C)CC3)=O)C4=CC=CC=C14.[H]Cl.[H]Cl |
| Synonyms | LS519, LS-519, LS 519 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 1 mg/mL (2.35 mM) | |
| Water | 76 mg/mL (179.11 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.57 mL | 117.84 mL | 235.67 mL |
| 0.5 mM | 4.71 mL | 23.57 mL | 47.13 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.57 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
