Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pitolisant hydrochloride is a novel, potent, and selective nonimidazole inverse agonist at the recombinant human H3 receptor (Ki=0.16 nM). |
|---|
| Catalog Num | A15213 |
|---|---|
| Formula | C17H27Cl2NO |
| Molecular Weight | 332.31 |
| CAS Number | 903576-44-3 |
| SMILES | C1CCN(CC1)CCCOCCCC2=CC=C(C=C2)Cl.Cl |
| Synonyms | Ciproxidine, BF 2649, BF2649, BF-2649 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (171.52 mM) | |
| Water | 57 mg/mL (171.52 mM) | ||
| Ethanol | 57 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.09 mL | 150.46 mL | 300.92 mL |
| 0.5 mM | 6.02 mL | 30.09 mL | 60.18 mL |
| 1 mM | 3.01 mL | 15.05 mL | 30.09 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
