Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY333531 is a β-specific protein kinase C inhibitor. It competitively and reversibly inhibits PKCβ1 and PKCβ2 with IC50 values of 4.7 and 5.9 nM respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16604 |
|---|---|
| Formula | C28H28N4O3.HCl |
| Molecular Weight | 505.01 |
| CAS Number | 169939-93-9 |
| SMILES | O=C1NC(C2=C1C3=CN(C4=CC=CC=C34)CC[C@@H](CN(C)C)OCCN5C=C2C6=CC=CC=C56)=O.[H]Cl |
| Synonyms | LY-333531, LY 333531 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (97.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.8 mL | 99.01 mL | 198.02 mL |
| 0.5 mM | 3.96 mL | 19.8 mL | 39.6 mL |
| 1 mM | 1.98 mL | 9.9 mL | 19.8 mL |
| 5 mM | 0.4 mL | 1.98 mL | 3.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
